Products 2580228-83-5

CAS 2580228-83-5 is the registry number for Ethyl 2-fluoro-2-sulfamoylacetate. Offered by: Biosynth. Available pack sizes: 0,5g, 0,25g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-fluoro-2-sulfamoylacetate (CAS 2580228-83-5) is a chemical compound with the molecular formula C4H8FNO4S and a molecular weight of 185.18 g/mol. IUPAC name: ethyl 2-fluoro-2-sulfamoylacetate. InChIKey: ODQGDZGMQPUOHO-UHFFFAOYSA-N.

Identity
Molecular formulaC4H8FNO4S
Molecular weight185.18 g/mol
IUPAC nameethyl 2-fluoro-2-sulfamoylacetate
InChIKeyODQGDZGMQPUOHO-UHFFFAOYSA-N
SMILESCCOC(=O)C(F)S(=O)(=O)N

Computed by PubChem (NCBI)