CAS 258286-11-2 is the registry number for rac-(2R,4R)-2,4-Dimethylpiperidine hydrochloride. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
(2R,4R)-2,4-dimethylpiperidine;hydrochloride (CAS 258286-11-2) is a chemical compound with the molecular formula C7H16ClN and a molecular weight of 149.66 g/mol. IUPAC name: (2R,4R)-2,4-dimethylpiperidine;hydrochloride. InChIKey: ZNWYEICTMCDWMH-ZJLYAJKPSA-N.
| Molecular formula | C7H16ClN |
|---|---|
| Molecular weight | 149.66 g/mol |
| IUPAC name | (2R,4R)-2,4-dimethylpiperidine;hydrochloride |
| InChIKey | ZNWYEICTMCDWMH-ZJLYAJKPSA-N |
| SMILES | C[C@@H]1CCN[C@@H](C1)C.Cl |
Computed by PubChem (NCBI)