CAS 25832-71-7 appears in our catalog under these names: 5-Methoxysalicylic acid sodium, 95%, 5-Methoxysalicylic acid sodium. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg.
Sodium 2-hydroxy-5-methoxybenzoate (CAS 25832-71-7) is a chemical compound with the molecular formula C8H7NaO4 and a molecular weight of 190.13 g/mol. IUPAC name: sodium 2-hydroxy-5-methoxybenzoate. InChIKey: XBYKLNAHPCSCOD-UHFFFAOYSA-M.
| Molecular formula | C8H7NaO4 |
|---|---|
| Molecular weight | 190.13 g/mol |
| IUPAC name | sodium 2-hydroxy-5-methoxybenzoate |
| InChIKey | XBYKLNAHPCSCOD-UHFFFAOYSA-M |
| SMILES | COC1=CC(=C(C=C1)O)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)