CAS 25834-16-6 appears in our catalog under these names: 1,3–Isobenzofurandione, 4,7–dibromo, 3,6-Dibromophthalic Anhydride, >98.0%(T), 1,3-Isobenzofurandione, 4,7-dibromo, 98%, 98%, 1,3-Isobenzofurandione, 4,7-dibromo, 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 200mg, 100mg, 250mg, 10g, 25g.
4,7-dibromo-2-benzofuran-1,3-dione (CAS 25834-16-6) is a chemical compound with the molecular formula C8H2Br2O3 and a molecular weight of 305.91 g/mol. IUPAC name: 4,7-dibromo-2-benzofuran-1,3-dione. InChIKey: OUAOHMOFJGFOSR-UHFFFAOYSA-N.
| Molecular formula | C8H2Br2O3 |
|---|---|
| Molecular weight | 305.91 g/mol |
| IUPAC name | 4,7-dibromo-2-benzofuran-1,3-dione |
| InChIKey | OUAOHMOFJGFOSR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Br)C(=O)OC2=O)Br |
Computed by PubChem (NCBI)