CAS 258347-71-6 is the registry number for ((4-(Dimethylamino)phenyl)(hydroxy)methyl)diphenylphosphine oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-(dimethylamino)phenyl]-diphenylphosphorylmethanol (CAS 258347-71-6) is a chemical compound with the molecular formula C21H22NO2P and a molecular weight of 351.4 g/mol. IUPAC name: [4-(dimethylamino)phenyl]-diphenylphosphorylmethanol. InChIKey: YGZOJJVDSWQLDW-UHFFFAOYSA-N.
| Molecular formula | C21H22NO2P |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | [4-(dimethylamino)phenyl]-diphenylphosphorylmethanol |
| InChIKey | YGZOJJVDSWQLDW-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(O)P(=O)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)