CAS 25837-47-2 appears in our catalog under these names: Phenylacetylene-d6, 98 atom % D, min 98% Chemical Purity, PHENYLACETYLENE-D6, 98 ATOM % D, 98% CP, 1-(Ethynyl-d)benzene-2,3,4,5,6-d5. Offered by: CDN, Sigma-Aldrich, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 100MG, 100 mg, 50 mg, 25 mg.
1,2,3,4,5-pentadeuterio-6-(2-deuterioethynyl)benzene (CAS 25837-47-2) is a chemical compound with the molecular formula C8H6 and a molecular weight of 108.17 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-(2-deuterioethynyl)benzene. InChIKey: UEXCJVNBTNXOEH-HLGHPJLRSA-N.
| Molecular formula | C8H6 |
|---|---|
| Molecular weight | 108.17 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-(2-deuterioethynyl)benzene |
| InChIKey | UEXCJVNBTNXOEH-HLGHPJLRSA-N |
| SMILES | [2H]C#CC1=C(C(=C(C(=C1[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)