CAS 2584-47-6 appears in our catalog under these names: 1,4-Dimethylquinolin-2(1H)-one 97%, 1,4-Dimethylquinolin-2(1H)-one, 98%, 98%, 1,4-Dimethylquinolin-2(1H)-one, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 100g.
1,4-dimethylquinolin-2-one (CAS 2584-47-6) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 1,4-dimethylquinolin-2-one. InChIKey: CEONKCOBRZOYJS-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 1,4-dimethylquinolin-2-one |
| InChIKey | CEONKCOBRZOYJS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(C2=CC=CC=C12)C |
Computed by PubChem (NCBI)