CAS 25844-48-8 appears in our catalog under these names: 3-Amino-n-3-pyridinylbenzamide, 95%, 3-Amino-N-pyridin-3-ylbenzamide, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
3-amino-N-pyridin-3-ylbenzamide (CAS 25844-48-8) is a chemical compound with the molecular formula C12H11N3O and a molecular weight of 213.23 g/mol. IUPAC name: 3-amino-N-pyridin-3-ylbenzamide. InChIKey: ROXMEGSVJDLDHD-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 3-amino-N-pyridin-3-ylbenzamide |
| InChIKey | ROXMEGSVJDLDHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C(=O)NC2=CN=CC=C2 |
Computed by PubChem (NCBI)