Products 2584947-54-4
CAS 2584947-54-4 is the registry number for PXS-6302. Offered by: MedChemExpress. Available pack sizes: Get quote.
(Z)-4-(benzenesulfonyl)-3,4,4-trifluorobut-2-en-1-amine (CAS 2584947-54-4) is a chemical compound with the molecular formula C10H10F3NO2S and a molecular weight of 265.25 g/mol. IUPAC name: (Z)-4-(benzenesulfonyl)-3,4,4-trifluorobut-2-en-1-amine. InChIKey: CQBDTOILYHIRIW-TWGQIWQCSA-N.
| Molecular formula | C10H10F3NO2S |
|---|---|
| Molecular weight | 265.25 g/mol |
| IUPAC name | (Z)-4-(benzenesulfonyl)-3,4,4-trifluorobut-2-en-1-amine |
| InChIKey | CQBDTOILYHIRIW-TWGQIWQCSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)C(/C(=C/CN)/F)(F)F |
Computed by PubChem (NCBI)