CAS 258516-87-9 appears in our catalog under these names: Fospropofol, Aquavan, >95% (HPLC), Fospropofol disodium. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg.
Disodium;[2,6-di(propan-2-yl)phenoxy]methyl phosphate (CAS 258516-87-9) is a chemical compound with the molecular formula C13H19Na2O5P and a molecular weight of 332.24 g/mol. IUPAC name: disodium;[2,6-di(propan-2-yl)phenoxy]methyl phosphate. InChIKey: LWYLQNWMSGFCOZ-UHFFFAOYSA-L.
| Molecular formula | C13H19Na2O5P |
|---|---|
| Molecular weight | 332.24 g/mol |
| IUPAC name | disodium;[2,6-di(propan-2-yl)phenoxy]methyl phosphate |
| InChIKey | LWYLQNWMSGFCOZ-UHFFFAOYSA-L |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)OCOP(=O)([O-])[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)