CAS 2586125-83-7 is the registry number for Methyl 6-bromo-2-fluoro-3-isopropoxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Methyl 6-bromo-2-fluoro-3-propan-2-yloxybenzoate (CAS 2586125-83-7) is a chemical compound with the molecular formula C11H12BrFO3 and a molecular weight of 291.11 g/mol. IUPAC name: methyl 6-bromo-2-fluoro-3-propan-2-yloxybenzoate. InChIKey: OMIYAKXJTBWBCC-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFO3 |
|---|---|
| Molecular weight | 291.11 g/mol |
| IUPAC name | methyl 6-bromo-2-fluoro-3-propan-2-yloxybenzoate |
| InChIKey | OMIYAKXJTBWBCC-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C(=C(C=C1)Br)C(=O)OC)F |
Computed by PubChem (NCBI)