CAS 2586125-85-9 appears in our catalog under these names: 2-(Benzyloxy)-5-bromo-1-fluoro-3-(trifluoromethyl)benzene, 95%, 2-(Benzyloxy)-5-bromo-1-fluoro-3-(trifluoromethyl)benzene, 98%, 2-(Benzyloxy)-5-bromo-1-fluoro-3-(trifluoromethyl)benzene. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
5-bromo-1-fluoro-2-phenylmethoxy-3-(trifluoromethyl)benzene (CAS 2586125-85-9) is a chemical compound with the molecular formula C14H9BrF4O and a molecular weight of 349.12 g/mol. IUPAC name: 5-bromo-1-fluoro-2-phenylmethoxy-3-(trifluoromethyl)benzene. InChIKey: CEOFTWYVOUJTPM-UHFFFAOYSA-N.
| Molecular formula | C14H9BrF4O |
|---|---|
| Molecular weight | 349.12 g/mol |
| IUPAC name | 5-bromo-1-fluoro-2-phenylmethoxy-3-(trifluoromethyl)benzene |
| InChIKey | CEOFTWYVOUJTPM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2F)Br)C(F)(F)F |
Computed by PubChem (NCBI)