CAS 2586125-95-1 is the registry number for 1-(Benzyloxy)-2-fluoro-3-iodo-5-(trifluoromethyl)benzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-fluoro-1-iodo-3-phenylmethoxy-5-(trifluoromethyl)benzene (CAS 2586125-95-1) is a chemical compound with the molecular formula C14H9F4IO and a molecular weight of 396.12 g/mol. IUPAC name: 2-fluoro-1-iodo-3-phenylmethoxy-5-(trifluoromethyl)benzene. InChIKey: IXOWIILDEZDZBA-UHFFFAOYSA-N.
| Molecular formula | C14H9F4IO |
|---|---|
| Molecular weight | 396.12 g/mol |
| IUPAC name | 2-fluoro-1-iodo-3-phenylmethoxy-5-(trifluoromethyl)benzene |
| InChIKey | IXOWIILDEZDZBA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=CC(=C2)C(F)(F)F)I)F |
Computed by PubChem (NCBI)