Products 2586126-19-2

CAS 2586126-19-2 is the registry number for 1,3-Dibromo-5-(4-methoxybenzyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1,3-dibromo-5-[(4-methoxyphenyl)methyl]benzene (CAS 2586126-19-2) is a chemical compound with the molecular formula C14H12Br2O and a molecular weight of 356.05 g/mol. IUPAC name: 1,3-dibromo-5-[(4-methoxyphenyl)methyl]benzene. InChIKey: LJPMNUGIRMLLCR-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12Br2O
Molecular weight356.05 g/mol
IUPAC name1,3-dibromo-5-[(4-methoxyphenyl)methyl]benzene
InChIKeyLJPMNUGIRMLLCR-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)CC2=CC(=CC(=C2)Br)Br

Computed by PubChem (NCBI)