CAS 2586126-38-5 is the registry number for 1-Bromo-3,4-difluoro-5-iodo-2-isopropoxybenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
1-bromo-3,4-difluoro-5-iodo-2-propan-2-yloxybenzene (CAS 2586126-38-5) is a chemical compound with the molecular formula C9H8BrF2IO and a molecular weight of 376.96 g/mol. IUPAC name: 1-bromo-3,4-difluoro-5-iodo-2-propan-2-yloxybenzene. InChIKey: FDWFXNLENYFSQN-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF2IO |
|---|---|
| Molecular weight | 376.96 g/mol |
| IUPAC name | 1-bromo-3,4-difluoro-5-iodo-2-propan-2-yloxybenzene |
| InChIKey | FDWFXNLENYFSQN-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C(=C(C=C1Br)I)F)F |
Computed by PubChem (NCBI)