Products 2586126-68-1
CAS 2586126-68-1 appears in our catalog under these names: 3-Bromo-6-chloro-2-fluoro-n,n-dimethylbenzamide, 95%, 3-Bromo-6-chloro-2-fluoro-N,N-dimethylbenzamide, 98%, 3-bromo-6-chloro-2-fluoro-N,N-dimethylbenzamide, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
3-bromo-6-chloro-2-fluoro-N,N-dimethylbenzamide (CAS 2586126-68-1) is a chemical compound with the molecular formula C9H8BrClFNO and a molecular weight of 280.52 g/mol. IUPAC name: 3-bromo-6-chloro-2-fluoro-N,N-dimethylbenzamide. InChIKey: FCOKKBVHNQTHKT-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClFNO |
|---|---|
| Molecular weight | 280.52 g/mol |
| IUPAC name | 3-bromo-6-chloro-2-fluoro-N,N-dimethylbenzamide |
| InChIKey | FCOKKBVHNQTHKT-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=CC(=C1F)Br)Cl |
Computed by PubChem (NCBI)