CAS 2586126-78-3 appears in our catalog under these names: tert-Butyl 2,4-bis(trifluoromethyl)benzoate, 97%, tert-Butyl 2,4-bis(trifluoromethyl)benzoate, 98%, Tert-butyl 2,4-bis(trifluoromethyl)benzoate. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g.
Tert-butyl 2,4-bis(trifluoromethyl)benzoate (CAS 2586126-78-3) is a chemical compound with the molecular formula C13H12F6O2 and a molecular weight of 314.22 g/mol. IUPAC name: tert-butyl 2,4-bis(trifluoromethyl)benzoate. InChIKey: LCWHFGPWKRCFEX-UHFFFAOYSA-N.
| Molecular formula | C13H12F6O2 |
|---|---|
| Molecular weight | 314.22 g/mol |
| IUPAC name | tert-butyl 2,4-bis(trifluoromethyl)benzoate |
| InChIKey | LCWHFGPWKRCFEX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=C(C=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)