Products 2587360-22-1
CAS 2587360-22-1 appears in our catalog under these names: Ecopipam (hydrobromide), 99.0%, Ecopipam (hydrobromide), 99%, SCH-39166 hydrobromide >= 98 % HPLC. Offered by: MedChemExpress, Chemat, Sigma-Aldrich. Available pack sizes: 1 mg, 1mg, 25MG, 5MG.
(6aS,13bR)-11-chloro-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-12-ol;hydrobromide (CAS 2587360-22-1) is a chemical compound with the molecular formula C19H21BrClNO and a molecular weight of 394.7 g/mol. IUPAC name: (6aS,13bR)-11-chloro-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-12-ol;hydrobromide. InChIKey: GAUWIDFICGEZKR-JUOYHRLASA-N.
| Molecular formula | C19H21BrClNO |
|---|---|
| Molecular weight | 394.7 g/mol |
| IUPAC name | (6aS,13bR)-11-chloro-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-12-ol;hydrobromide |
| InChIKey | GAUWIDFICGEZKR-JUOYHRLASA-N |
| SMILES | CN1CCC2=CC(=C(C=C2[C@@H]3[C@@H]1CCC4=CC=CC=C34)O)Cl.Br |
Computed by PubChem (NCBI)