CAS 25875-50-7 appears in our catalog under these names: Robenidine hydrochloride, 95%, Robenidine HCl, Robenidine Hydrochloride, Robenidine hydrochloride 100 µg/mL in Acetone:Methanol, Robenidine Hydrochloride, >95% (HPLC). Offered by: Combi-blocks, Chemat Brand, Mikromol, LoGiCal, Dr. Ehrenstorfer. Available pack sizes: 5g, 25g, 1g, on request, 250mg, 10mg, 100mg, 1ml.
1,2-bis[(E)-(4-chlorophenyl)methylideneamino]guanidine;hydrochloride (CAS 25875-50-7) is a chemical compound with the molecular formula C15H14Cl3N5 and a molecular weight of 370.7 g/mol. IUPAC name: 1,2-bis[(E)-(4-chlorophenyl)methylideneamino]guanidine;hydrochloride. InChIKey: LTWIBTYLSRDGHP-HCURTGQUSA-N.
| Molecular formula | C15H14Cl3N5 |
|---|---|
| Molecular weight | 370.7 g/mol |
| IUPAC name | 1,2-bis[(E)-(4-chlorophenyl)methylideneamino]guanidine;hydrochloride |
| InChIKey | LTWIBTYLSRDGHP-HCURTGQUSA-N |
| SMILES | C1=CC(=CC=C1/C=N/N/C(=N/N=C/C2=CC=C(C=C2)Cl)/N)Cl.Cl |
Computed by PubChem (NCBI)