CAS 258851-00-2 is the registry number for RAF-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(4-tert-butylphenyl)-4-(pyridin-4-ylmethyl)isoquinolin-1-amine (CAS 258851-00-2) is a chemical compound with the molecular formula C25H25N3 and a molecular weight of 367.5 g/mol. IUPAC name: N-(4-tert-butylphenyl)-4-(pyridin-4-ylmethyl)isoquinolin-1-amine. InChIKey: XJGOPYWCSIEHLX-UHFFFAOYSA-N.
| Molecular formula | C25H25N3 |
|---|---|
| Molecular weight | 367.5 g/mol |
| IUPAC name | N-(4-tert-butylphenyl)-4-(pyridin-4-ylmethyl)isoquinolin-1-amine |
| InChIKey | XJGOPYWCSIEHLX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)NC2=NC=C(C3=CC=CC=C32)CC4=CC=NC=C4 |
Computed by PubChem (NCBI)