Products 258854-80-7
CAS 258854-80-7 is the registry number for 3-Pyridinecarboxaldehyde-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
2,4,5,6-tetradeuteriopyridine-3-carbaldehyde (CAS 258854-80-7) is a chemical compound with the molecular formula C6H5NO and a molecular weight of 111.13 g/mol. IUPAC name: 2,4,5,6-tetradeuteriopyridine-3-carbaldehyde. InChIKey: QJZUKDFHGGYHMC-RHQRLBAQSA-N.
| Molecular formula | C6H5NO |
|---|---|
| Molecular weight | 111.13 g/mol |
| IUPAC name | 2,4,5,6-tetradeuteriopyridine-3-carbaldehyde |
| InChIKey | QJZUKDFHGGYHMC-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])C=O)[2H] |
Computed by PubChem (NCBI)