CAS 25899-70-1 appears in our catalog under these names: Xanthosine 5'-monophosphate disodium salt, 98%, 5'-Xanthylic Acid Disodium Salt, Xanthosine 5'–monophosphate (sodium salt), Xanthosine 5'-monophosphate sodium salt/ 98.74% (existing batch purity), Xanthosine 5'-monophosphate disodium salt. Offered by: Combi-blocks, Chemat Brand, GLPBio, TargetMol, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, on request, 100mg, 50mg, 20mg.
Disodium;[(2R,3S,4R,5R)-5-(2,6-dioxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate (CAS 25899-70-1) is a chemical compound with the molecular formula C10H11N4Na2O9P and a molecular weight of 408.17 g/mol. IUPAC name: disodium;[(2R,3S,4R,5R)-5-(2,6-dioxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate. InChIKey: QQPVYRBCIRHGSZ-LGVAUZIVSA-L.
| Molecular formula | C10H11N4Na2O9P |
|---|---|
| Molecular weight | 408.17 g/mol |
| IUPAC name | disodium;[(2R,3S,4R,5R)-5-(2,6-dioxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
| InChIKey | QQPVYRBCIRHGSZ-LGVAUZIVSA-L |
| SMILES | C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)([O-])[O-])O)O)NC(=O)NC2=O.[Na+].[Na+] |
Computed by PubChem (NCBI)