Products 259-84-7
CAS 259-84-7 is the registry number for 1,8-Diazabiphenylene. Offered by: Biosynth. Available pack sizes: 5mg, 2mg, 10mg.
3,12-diazatricyclo[6.4.0.02,7]dodeca-1(8),2(7),3,5,9,11-hexaene (CAS 259-84-7) is a chemical compound with the molecular formula C10H6N2 and a molecular weight of 154.17 g/mol. IUPAC name: 3,12-diazatricyclo[6.4.0.02,7]dodeca-1(8),2(7),3,5,9,11-hexaene. InChIKey: DAEHFBVYBVCKNC-UHFFFAOYSA-N.
| Molecular formula | C10H6N2 |
|---|---|
| Molecular weight | 154.17 g/mol |
| IUPAC name | 3,12-diazatricyclo[6.4.0.02,7]dodeca-1(8),2(7),3,5,9,11-hexaene |
| InChIKey | DAEHFBVYBVCKNC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C2C=CC=N3)N=C1 |
Computed by PubChem (NCBI)