CAS 2591-44-8 is the registry number for (2-Methylallyl)triphenylstannane. Offered by: TRC. Available pack sizes: 500mg, 5g.
2-methylprop-2-enyl(triphenyl)stannane (CAS 2591-44-8) is a chemical compound with the molecular formula C22H22Sn and a molecular weight of 405.1 g/mol. IUPAC name: 2-methylprop-2-enyl(triphenyl)stannane. InChIKey: ZHXNQMXQECPOQN-UHFFFAOYSA-N.
| Molecular formula | C22H22Sn |
|---|---|
| Molecular weight | 405.1 g/mol |
| IUPAC name | 2-methylprop-2-enyl(triphenyl)stannane |
| InChIKey | ZHXNQMXQECPOQN-UHFFFAOYSA-N |
| SMILES | CC(=C)C[Sn](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)