CAS 25910-85-4 appears in our catalog under these names: Pinacryptol yellow, 95%, 6-Ethoxy-1-methyl-2-(3-nitrostyryl)quinolin-1-ium methyl sulfate, 97%, Pinakryptol Yellow, Pinakryptol Yellow, Quinolinium, 6-ethoxy-1-methyl-2-[2-(3-nitrophenyl)ethenyl]-, methyl sulfate (1:1). Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 250mg, 1g, 100mg.
6-ethoxy-1-methyl-2-[(E)-2-(3-nitrophenyl)ethenyl]quinolin-1-ium;methyl sulfate (CAS 25910-85-4) is a chemical compound with the molecular formula C21H22N2O7S and a molecular weight of 446.5 g/mol. IUPAC name: 6-ethoxy-1-methyl-2-[(E)-2-(3-nitrophenyl)ethenyl]quinolin-1-ium;methyl sulfate. InChIKey: ZXQHSPWBYMLHLB-BXTVWIJMSA-M.
| Molecular formula | C21H22N2O7S |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | 6-ethoxy-1-methyl-2-[(E)-2-(3-nitrophenyl)ethenyl]quinolin-1-ium;methyl sulfate |
| InChIKey | ZXQHSPWBYMLHLB-BXTVWIJMSA-M |
| SMILES | CCOC1=CC2=C(C=C1)[N+](=C(C=C2)/C=C/C3=CC(=CC=C3)[N+](=O)[O-])C.COS(=O)(=O)[O-] |
Computed by PubChem (NCBI)