CAS 2591612-04-1 is the registry number for 8-Chloro-1-isopropyl-1H-[1,2,3]triazolo[4,5-h]quinazoline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-1-propan-2-yltriazolo[4,5-h]quinazoline (CAS 2591612-04-1) is a chemical compound with the molecular formula C11H10ClN5 and a molecular weight of 247.68 g/mol. IUPAC name: 8-chloro-1-propan-2-yltriazolo[4,5-h]quinazoline. InChIKey: QZJMNPKKFYPAFF-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN5 |
|---|---|
| Molecular weight | 247.68 g/mol |
| IUPAC name | 8-chloro-1-propan-2-yltriazolo[4,5-h]quinazoline |
| InChIKey | QZJMNPKKFYPAFF-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=C(C=CC3=CN=C(N=C32)Cl)N=N1 |
Computed by PubChem (NCBI)