CAS 2592-19-0 appears in our catalog under these names: Boc-Lys(Boc)-ONp, Boc–Lys(Boc)–ONp, Boc-L-Lys(Boc)-ONp, N-alpha,epsilon-Bis-Boc-L-lysine 4-nitrophenyl ester, Boc-Lys(Boc)-ONp 98%. Offered by: Chemat Brand, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: on request, 25g, 5g, 100g, 10g, 50g, 250g, 1g.
(4-nitrophenyl) 2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (CAS 2592-19-0) is a chemical compound with the molecular formula C22H33N3O8 and a molecular weight of 467.5 g/mol. IUPAC name: (4-nitrophenyl) 2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate. InChIKey: LYUXBTAUKJETMS-UHFFFAOYSA-N.
| Molecular formula | C22H33N3O8 |
|---|---|
| Molecular weight | 467.5 g/mol |
| IUPAC name | (4-nitrophenyl) 2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| InChIKey | LYUXBTAUKJETMS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCC(C(=O)OC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)