CAS 2592405-78-0 is the registry number for Methyl 3-bromo-5-(2-bromo-1-fluoroethyl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-bromo-5-(2-bromo-1-fluoroethyl)benzoate (CAS 2592405-78-0) is a chemical compound with the molecular formula C10H9Br2FO2 and a molecular weight of 339.98 g/mol. IUPAC name: methyl 3-bromo-5-(2-bromo-1-fluoroethyl)benzoate. InChIKey: BRDKXAHQOMALGD-UHFFFAOYSA-N.
| Molecular formula | C10H9Br2FO2 |
|---|---|
| Molecular weight | 339.98 g/mol |
| IUPAC name | methyl 3-bromo-5-(2-bromo-1-fluoroethyl)benzoate |
| InChIKey | BRDKXAHQOMALGD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C(CBr)F)Br |
Computed by PubChem (NCBI)