CAS 2593177-94-5 is the registry number for (5-Chloro-8-methoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methanamine dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(5-chloro-8-methoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methanamine;dihydrochloride (CAS 2593177-94-5) is a chemical compound with the molecular formula C11H17Cl3N2O and a molecular weight of 299.6 g/mol. IUPAC name: (5-chloro-8-methoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methanamine;dihydrochloride. InChIKey: ASRMVDMLKJHQSC-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl3N2O |
|---|---|
| Molecular weight | 299.6 g/mol |
| IUPAC name | (5-chloro-8-methoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methanamine;dihydrochloride |
| InChIKey | ASRMVDMLKJHQSC-UHFFFAOYSA-N |
| SMILES | COC1=C2C(NCCC2=C(C=C1)Cl)CN.Cl.Cl |
Computed by PubChem (NCBI)