CAS 926660-93-7 appears in our catalog under these names: 1-(4-Chloro-3-methoxyphenyl)-piperazine dihydrochloride, 95%, 1-(4-Chloro-3-methoxyphenyl)-piperazine dihydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 1000mg, 5000mg.
1-(4-chloro-3-methoxyphenyl)piperazine;dihydrochloride (CAS 926660-93-7) is a chemical compound with the molecular formula C11H17Cl3N2O and a molecular weight of 299.6 g/mol. IUPAC name: 1-(4-chloro-3-methoxyphenyl)piperazine;dihydrochloride. InChIKey: MEIPHNQDFQGCHN-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl3N2O |
|---|---|
| Molecular weight | 299.6 g/mol |
| IUPAC name | 1-(4-chloro-3-methoxyphenyl)piperazine;dihydrochloride |
| InChIKey | MEIPHNQDFQGCHN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N2CCNCC2)Cl.Cl.Cl |
Computed by PubChem (NCBI)