Products 2593197-18-1
CAS 2593197-18-1 is the registry number for 5–fluoro MDMB–PICA metabolite 4. Offered by: GLPBio. Available pack sizes: 1mg.
(2S)-2-[[1-(5-fluoro-4-hydroxypentyl)indole-3-carbonyl]amino]-3,3-dimethylbutanoic acid (CAS 2593197-18-1) is a chemical compound with the molecular formula C20H27FN2O4 and a molecular weight of 378.4 g/mol. IUPAC name: (2S)-2-[[1-(5-fluoro-4-hydroxypentyl)indole-3-carbonyl]amino]-3,3-dimethylbutanoic acid. InChIKey: ZFYMODMFKRMLJY-LRHAYUFXSA-N.
| Molecular formula | C20H27FN2O4 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | (2S)-2-[[1-(5-fluoro-4-hydroxypentyl)indole-3-carbonyl]amino]-3,3-dimethylbutanoic acid |
| InChIKey | ZFYMODMFKRMLJY-LRHAYUFXSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)O)NC(=O)C1=CN(C2=CC=CC=C21)CCCC(CF)O |
Computed by PubChem (NCBI)