CAS 25940-35-6 appears in our catalog under these names: Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid, 95%, Pyrazolo(1,5-a)pyrimidine-3-carboxylic acid, Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid 97%, PYRAZOLO[1,5-A]PYRIMIDINE-3-CARBOXYLIC &, Pyrazolo[1,5-A]Pyrimidine-3-Carboxylic Acid, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 10g, 100g, 25g, 5g, 1g, 50g, 500g, 15g.
Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid (CAS 25940-35-6) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: pyrazolo[1,5-a]pyrimidine-3-carboxylic acid. InChIKey: HNYVPKNVKSTVJO-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | pyrazolo[1,5-a]pyrimidine-3-carboxylic acid |
| InChIKey | HNYVPKNVKSTVJO-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C(C=N2)C(=O)O)N=C1 |
Computed by PubChem (NCBI)