CAS 25944-28-9 is the registry number for 4,9-Dimethoxy-5-oxo-5h-furo[3,2-g]chromene-7-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4,9-dimethoxy-5-oxofuro[3,2-g]chromene-7-carboxylic acid (CAS 25944-28-9) is a chemical compound with the molecular formula C14H10O7 and a molecular weight of 290.22 g/mol. IUPAC name: 4,9-dimethoxy-5-oxofuro[3,2-g]chromene-7-carboxylic acid. InChIKey: RQRSLXAHKHZWDY-UHFFFAOYSA-N.
| Molecular formula | C14H10O7 |
|---|---|
| Molecular weight | 290.22 g/mol |
| IUPAC name | 4,9-dimethoxy-5-oxofuro[3,2-g]chromene-7-carboxylic acid |
| InChIKey | RQRSLXAHKHZWDY-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=O)C=C(OC2=C(C3=C1C=CO3)OC)C(=O)O |
Computed by PubChem (NCBI)