Products 25944-28-9

CAS 25944-28-9 is the registry number for 4,9-Dimethoxy-5-oxo-5h-furo[3,2-g]chromene-7-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

4,9-dimethoxy-5-oxofuro[3,2-g]chromene-7-carboxylic acid (CAS 25944-28-9) is a chemical compound with the molecular formula C14H10O7 and a molecular weight of 290.22 g/mol. IUPAC name: 4,9-dimethoxy-5-oxofuro[3,2-g]chromene-7-carboxylic acid. InChIKey: RQRSLXAHKHZWDY-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10O7
Molecular weight290.22 g/mol
IUPAC name4,9-dimethoxy-5-oxofuro[3,2-g]chromene-7-carboxylic acid
InChIKeyRQRSLXAHKHZWDY-UHFFFAOYSA-N
SMILESCOC1=C2C(=O)C=C(OC2=C(C3=C1C=CO3)OC)C(=O)O

Computed by PubChem (NCBI)