CAS 2595-90-6 appears in our catalog under these names: 3-(Bromomethyl)pyrene, 90%, 1-(Bromomethyl)pyrene, 90%, 1-(Bromomethyl)pyrene 90%, 1-(Bromomethyl)pyrene, 1–(Bromomethyl)pyrene. Offered by: Combi-blocks, AmBeed, Fluorochem, TRC, GLPBio. Available pack sizes: 5g, 1g, 25g, 250mg, 100mg, 10g, 50mg, 2g.
1-(bromomethyl)pyrene (CAS 2595-90-6) is a chemical compound with the molecular formula C17H11Br and a molecular weight of 295.2 g/mol. IUPAC name: 1-(bromomethyl)pyrene. InChIKey: UGMXRPVWWWDPFC-UHFFFAOYSA-N.
| Molecular formula | C17H11Br |
|---|---|
| Molecular weight | 295.2 g/mol |
| IUPAC name | 1-(bromomethyl)pyrene |
| InChIKey | UGMXRPVWWWDPFC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)CBr |
Computed by PubChem (NCBI)