CAS 25953-14-4 appears in our catalog under these names: 5'-Iodo-5'-deoxythymidine, 95%, 5'-Deoxy-5'-iodothymidine, 5’-Deoxy-5’-iodothymidine, ≥95%, ≥95%, 5'-Deoxy-5‘-iodothymidine. Offered by: Combi-blocks, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 500mg, 1000mg, 2000mg, 5mg, 25mg, 50mg.
1-[(2R,4S,5S)-4-hydroxy-5-(iodomethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 25953-14-4) is a chemical compound with the molecular formula C10H13IN2O4 and a molecular weight of 352.13 g/mol. IUPAC name: 1-[(2R,4S,5S)-4-hydroxy-5-(iodomethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: LEQXAJKTJWCXEC-XLPZGREQSA-N.
| Molecular formula | C10H13IN2O4 |
|---|---|
| Molecular weight | 352.13 g/mol |
| IUPAC name | 1-[(2R,4S,5S)-4-hydroxy-5-(iodomethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | LEQXAJKTJWCXEC-XLPZGREQSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CI)O |
Computed by PubChem (NCBI)