Products 259674-19-6
CAS 259674-19-6 appears in our catalog under these names: Trpm8 antagonist 2, 95%, TRPM8 antagonist 2/ 98%, TRPM8 Antagonist, TRPM8 antagonist 2 98+%, N,N-Bis(phenylmethyl)-L-tryptophan methyl ester, 98+%, 98+%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 100mg, 1g, 1mg, 5mg, 10mg, 25mg, 50mg.
Methyl (2S)-2-(dibenzylamino)-3-(1H-indol-3-yl)propanoate (CAS 259674-19-6) is a chemical compound with the molecular formula C26H26N2O2 and a molecular weight of 398.5 g/mol. IUPAC name: methyl (2S)-2-(dibenzylamino)-3-(1H-indol-3-yl)propanoate. InChIKey: HHVOOJDLCVOLKI-VWLOTQADSA-N.
| Molecular formula | C26H26N2O2 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | methyl (2S)-2-(dibenzylamino)-3-(1H-indol-3-yl)propanoate |
| InChIKey | HHVOOJDLCVOLKI-VWLOTQADSA-N |
| SMILES | COC(=O)[C@H](CC1=CNC2=CC=CC=C21)N(CC3=CC=CC=C3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)