CAS 259731-40-3 is the registry number for (R)-Desmethyl Sibutramine Hydrochloride. Offered by: TRC. Available pack sizes: 100mg, 10mg.
(1R)-1-[1-(4-chlorophenyl)cyclobutyl]-N,3-dimethylbutan-1-amine;hydrochloride (CAS 259731-40-3) is a chemical compound with the molecular formula C16H25Cl2N and a molecular weight of 302.3 g/mol. IUPAC name: (1R)-1-[1-(4-chlorophenyl)cyclobutyl]-N,3-dimethylbutan-1-amine;hydrochloride. InChIKey: OUVFHVJVFLFXPQ-XFULWGLBSA-N.
| Molecular formula | C16H25Cl2N |
|---|---|
| Molecular weight | 302.3 g/mol |
| IUPAC name | (1R)-1-[1-(4-chlorophenyl)cyclobutyl]-N,3-dimethylbutan-1-amine;hydrochloride |
| InChIKey | OUVFHVJVFLFXPQ-XFULWGLBSA-N |
| SMILES | CC(C)C[C@H](C1(CCC1)C2=CC=C(C=C2)Cl)NC.Cl |
Computed by PubChem (NCBI)