CAS 2597936-98-4 is the registry number for Methyl 5,7-dioxo-4,5,6,7-tetrahydrothieno[3,2-b]pyridine-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5,7-dioxo-4H-thieno[3,2-b]pyridine-6-carboxylate (CAS 2597936-98-4) is a chemical compound with the molecular formula C9H7NO4S and a molecular weight of 225.22 g/mol. IUPAC name: methyl 5,7-dioxo-4H-thieno[3,2-b]pyridine-6-carboxylate. InChIKey: QWAGOXMZPGLUGI-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4S |
|---|---|
| Molecular weight | 225.22 g/mol |
| IUPAC name | methyl 5,7-dioxo-4H-thieno[3,2-b]pyridine-6-carboxylate |
| InChIKey | QWAGOXMZPGLUGI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1C(=O)C2=C(C=CS2)NC1=O |
Computed by PubChem (NCBI)