CAS 259810-15-6 appears in our catalog under these names: Lithium 6,7-dihydro-4H-pyrano(4,3-d)thiazole-2-carboxylate, 98%, Lithium 4H,6H,7H-pyrano(4,3-d)(1,3)thiazole-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Lithium 6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazole-2-carboxylate (CAS 259810-15-6) is a chemical compound with the molecular formula C7H6LiNO3S and a molecular weight of 191.2 g/mol. IUPAC name: lithium 6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazole-2-carboxylate. InChIKey: ZOKRNTGZVAXUDE-UHFFFAOYSA-M.
| Molecular formula | C7H6LiNO3S |
|---|---|
| Molecular weight | 191.2 g/mol |
| IUPAC name | lithium 6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazole-2-carboxylate |
| InChIKey | ZOKRNTGZVAXUDE-UHFFFAOYSA-M |
| SMILES | [Li+].C1COCC2=C1N=C(S2)C(=O)[O-] |
Computed by PubChem (NCBI)