Products 2598870-98-3
CAS 2598870-98-3 is the registry number for 4-Bromo-6-ethoxy-3-methyl-9H-pyrazolo[3',4':3,4]pyrazolo[1,5-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
12-bromo-10-ethoxy-3-methyl-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene (CAS 2598870-98-3) is a chemical compound with the molecular formula C11H11BrN4O and a molecular weight of 295.14 g/mol. IUPAC name: 12-bromo-10-ethoxy-3-methyl-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene. InChIKey: QKJNLAJUNNKZPP-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN4O |
|---|---|
| Molecular weight | 295.14 g/mol |
| IUPAC name | 12-bromo-10-ethoxy-3-methyl-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene |
| InChIKey | QKJNLAJUNNKZPP-UHFFFAOYSA-N |
| SMILES | CCOC1=CN2C(=C3C(=NNC3=N2)C)C(=C1)Br |
Computed by PubChem (NCBI)