CAS 930979-90-1 is the registry number for N-(3-Bromophenyl)-3-(1H-1,2,4-triazol-1-yl)propanamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-bromophenyl)-3-(1,2,4-triazol-1-yl)propanamide (CAS 930979-90-1) is a chemical compound with the molecular formula C11H11BrN4O and a molecular weight of 295.14 g/mol. IUPAC name: N-(3-bromophenyl)-3-(1,2,4-triazol-1-yl)propanamide. InChIKey: FJOOKVCVXNIALE-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN4O |
|---|---|
| Molecular weight | 295.14 g/mol |
| IUPAC name | N-(3-bromophenyl)-3-(1,2,4-triazol-1-yl)propanamide |
| InChIKey | FJOOKVCVXNIALE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)NC(=O)CCN2C=NC=N2 |
Computed by PubChem (NCBI)