CAS 25992-22-7 is the registry number for Dl-fosfomycin calcium, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
Calcium (3-methyloxiran-2-yl)-dioxido-oxo-lambda5-phosphane (CAS 25992-22-7) is a chemical compound with the molecular formula C3H5CaO4P and a molecular weight of 176.12 g/mol. IUPAC name: calcium (3-methyloxiran-2-yl)-dioxido-oxo-lambda5-phosphane. InChIKey: YMZJBJPWTXJQMR-UHFFFAOYSA-L.
| Molecular formula | C3H5CaO4P |
|---|---|
| Molecular weight | 176.12 g/mol |
| IUPAC name | calcium (3-methyloxiran-2-yl)-dioxido-oxo-lambda5-phosphane |
| InChIKey | YMZJBJPWTXJQMR-UHFFFAOYSA-L |
| SMILES | CC1C(O1)P(=O)([O-])[O-].[Ca+2] |
Computed by PubChem (NCBI)