CAS 2599553-35-0 is the registry number for Ethyl 6-bromo-1H-imidazo[4,5-b]pyrazine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-bromo-3H-imidazo[4,5-b]pyrazine-2-carboxylate (CAS 2599553-35-0) is a chemical compound with the molecular formula C8H7BrN4O2 and a molecular weight of 271.07 g/mol. IUPAC name: ethyl 5-bromo-3H-imidazo[4,5-b]pyrazine-2-carboxylate. InChIKey: XXGFCDJOMWKBKF-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4O2 |
|---|---|
| Molecular weight | 271.07 g/mol |
| IUPAC name | ethyl 5-bromo-3H-imidazo[4,5-b]pyrazine-2-carboxylate |
| InChIKey | XXGFCDJOMWKBKF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=NC=C(N=C2N1)Br |
Computed by PubChem (NCBI)