CAS 2601592-84-9 is the registry number for 5-Bromo-1,3-dihydro-2H-imidazo[4,5-b]pyrazine-2-thione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-1,3-dihydroimidazo[4,5-b]pyrazine-2-thione (CAS 2601592-84-9) is a chemical compound with the molecular formula C5H3BrN4S and a molecular weight of 231.08 g/mol. IUPAC name: 5-bromo-1,3-dihydroimidazo[4,5-b]pyrazine-2-thione. InChIKey: UMFBOPRGZZADOC-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN4S |
|---|---|
| Molecular weight | 231.08 g/mol |
| IUPAC name | 5-bromo-1,3-dihydroimidazo[4,5-b]pyrazine-2-thione |
| InChIKey | UMFBOPRGZZADOC-UHFFFAOYSA-N |
| SMILES | C1=C(N=C2C(=N1)NC(=S)N2)Br |
Computed by PubChem (NCBI)