CAS 26016-99-9 appears in our catalog under these names: Fosfomycin sodium, 97%, Fosfomycin Disodium Salt, Fosfomycin Disodium Salt, >95% (HPLC), Fosfomycin sodium, Fosfomycin sodium/ 99.63% (existing batch purity). Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, TargetMol. Available pack sizes: 25g, 500g, 5g, 100g, 1g, on request, 100mg, 10g.
Disodium;[(2R,3S)-3-methyloxiran-2-yl]-dioxido-oxo-lambda5-phosphane (CAS 26016-99-9) is a chemical compound with the molecular formula C3H5Na2O4P and a molecular weight of 182.02 g/mol. IUPAC name: disodium;[(2R,3S)-3-methyloxiran-2-yl]-dioxido-oxo-lambda5-phosphane. InChIKey: QZIQJIKUVJMTDG-JSTPYPERSA-L.
| Molecular formula | C3H5Na2O4P |
|---|---|
| Molecular weight | 182.02 g/mol |
| IUPAC name | disodium;[(2R,3S)-3-methyloxiran-2-yl]-dioxido-oxo-lambda5-phosphane |
| InChIKey | QZIQJIKUVJMTDG-JSTPYPERSA-L |
| SMILES | C[C@H]1[C@H](O1)P(=O)([O-])[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)