CAS 2601734-99-8 appears in our catalog under these names: SIRT6 activator 12q, 98%, SIRT6 activator 12q, SIRT6 activator 12q 98%, SIRT6 activator 12q, 98%, 98%, SIRT6 activator 12q, 99.83%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 100mg, 25mg, 50mg, 250mg, 1mg, 100 mg.
N-benzhydryl-2-(1-benzofuran-2-yl)quinoline-4-carboxamide (CAS 2601734-99-8) is a chemical compound with the molecular formula C31H22N2O2 and a molecular weight of 454.5 g/mol. IUPAC name: N-benzhydryl-2-(1-benzofuran-2-yl)quinoline-4-carboxamide. InChIKey: JNULQPRWYHVXHT-UHFFFAOYSA-N.
| Molecular formula | C31H22N2O2 |
|---|---|
| Molecular weight | 454.5 g/mol |
| IUPAC name | N-benzhydryl-2-(1-benzofuran-2-yl)quinoline-4-carboxamide |
| InChIKey | JNULQPRWYHVXHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)NC(=O)C3=CC(=NC4=CC=CC=C43)C5=CC6=CC=CC=C6O5 |
Computed by PubChem (NCBI)