Products 2603381-71-9
CAS 2603381-71-9 appears in our catalog under these names: CDK7 ligand 2, 99.92%, CDK7 ligand 2, 95%. Offered by: MedChemExpress, Ambeed. Available pack sizes: 5 mg, 25 mg, 10 mg, 10mg, 25mg, 50mg, 100mg, 250mg.
4-[[5-[[(1S)-2-(dimethylamino)-1-phenylethyl]carbamoyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]carbamoyl]benzoic acid (CAS 2603381-71-9) is a chemical compound with the molecular formula C26H30N6O4 and a molecular weight of 490.6 g/mol. IUPAC name: 4-[[5-[[(1S)-2-(dimethylamino)-1-phenylethyl]carbamoyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]carbamoyl]benzoic acid. InChIKey: FWPHDQJJYVZOKA-HXUWFJFHSA-N.
| Molecular formula | C26H30N6O4 |
|---|---|
| Molecular weight | 490.6 g/mol |
| IUPAC name | 4-[[5-[[(1S)-2-(dimethylamino)-1-phenylethyl]carbamoyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]carbamoyl]benzoic acid |
| InChIKey | FWPHDQJJYVZOKA-HXUWFJFHSA-N |
| SMILES | CC1(C2=C(CN1C(=O)N[C@H](CN(C)C)C3=CC=CC=C3)C(=NN2)NC(=O)C4=CC=C(C=C4)C(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
orb2646196