CAS 260446-76-2 is the registry number for (Diphenylphosphoryl)(pyridin-2-yl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
Diphenylphosphoryl(pyridin-2-yl)methanol (CAS 260446-76-2) is a chemical compound with the molecular formula C18H16NO2P and a molecular weight of 309.3 g/mol. IUPAC name: diphenylphosphoryl(pyridin-2-yl)methanol. InChIKey: URNAXILXPISJJH-UHFFFAOYSA-N.
| Molecular formula | C18H16NO2P |
|---|---|
| Molecular weight | 309.3 g/mol |
| IUPAC name | diphenylphosphoryl(pyridin-2-yl)methanol |
| InChIKey | URNAXILXPISJJH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C(C3=CC=CC=N3)O |
Computed by PubChem (NCBI)