Products 26050-44-2

CAS 26050-44-2 is the registry number for Rivastigmine Impurity 18. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-[1-(dimethylamino)ethyl]phenol (CAS 26050-44-2) is a chemical compound with the molecular formula C10H15NO and a molecular weight of 165.23 g/mol. IUPAC name: 2-[1-(dimethylamino)ethyl]phenol. InChIKey: SYOSODBLQVBZAY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15NO
Molecular weight165.23 g/mol
IUPAC name2-[1-(dimethylamino)ethyl]phenol
InChIKeySYOSODBLQVBZAY-UHFFFAOYSA-N
SMILESCC(C1=CC=CC=C1O)N(C)C

Computed by PubChem (NCBI)