Products 260553-24-0
CAS 260553-24-0 is the registry number for RBP4 ligand-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(5-chloro-2-methoxyphenyl)-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide (CAS 260553-24-0) is a chemical compound with the molecular formula C18H18ClF3N4O2 and a molecular weight of 414.8 g/mol. IUPAC name: N-(5-chloro-2-methoxyphenyl)-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide. InChIKey: PNEWYJAVBOHPBV-UHFFFAOYSA-N.
| Molecular formula | C18H18ClF3N4O2 |
|---|---|
| Molecular weight | 414.8 g/mol |
| IUPAC name | N-(5-chloro-2-methoxyphenyl)-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide |
| InChIKey | PNEWYJAVBOHPBV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Cl)NC(=O)N2CCN(CC2)C3=C(C=CC=N3)C(F)(F)F |
Computed by PubChem (NCBI)